C22H17N7O2S — CID 138581141
3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(5-cyano-2-hexacyclo[4.3.0.01,3.02,7.04,9.05,8]nonanyl)-4-methylbenzenesulfonamide (PubChem CID 138581141) has the molecular formula C22H17N7O2S and a molecular weight of 443.49 g/mol. Its IUPAC name is 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(5-cyano-2-hexacyclo[4.3.0.01,3.02,7.04,9.05,8]nonanyl)-4-methylbenzenesulfonamide.
| Compound Name | 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(5-cyano-2-hexacyclo[4.3.0.01,3.02,7.04,9.05,8]nonanyl)-4-methylbenzenesulfonamide |
|---|---|
| PubChem CID | 138581141 |
| Molecular Formula | C22H17N7O2S |
| Molecular Weight | 443.49 g/mol |
| Exact Mass | 443.12 |
| IUPAC Name | 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-N-(5-cyano-2-hexacyclo[4.3.0.01,3.02,7.04,9.05,8]nonanyl)-4-methylbenzenesulfonamide |
| SMILES | Cc1ccc(S(=O)(=O)NC23C4C5C6C7C2C63C4C57C#N)cc1-c1cnc2c(N)ncnn12 |
| InChI | InChI=1S/C22H17N7O2S/c1-8-2-3-9(4-10(8)11-5-25-19-18(24)26-7-27-29(11)19)32(30,31)28-22-15-12-13-14-17(22)21(13,22)16(15)20(12,14)6-23/h2-5,7,12-17,28H,1H3,(H2,24,26,27) |
| InChIKey | WEVRMBCYRKIFEU-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 139.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.49 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'cyclooctane_1', 'substructure': 'N/A'} |
|---|