C18H16ClN7O2S — CID 140831799
3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-chloro-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide (PubChem CID 140831799) has the molecular formula C18H16ClN7O2S and a molecular weight of 429.89 g/mol. Its IUPAC name is 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-chloro-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide.
| Compound Name | 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-chloro-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 140831799 |
| Molecular Formula | C18H16ClN7O2S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.08 |
| IUPAC Name | 3-(4-aminoimidazo[2,1-f][1,2,4]triazin-7-yl)-4-chloro-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide |
| SMILES | [C-]#[N+]C12CCC(NS(=O)(=O)c3ccc(Cl)c(-c4cnc5c(N)ncnn45)c3)(C1)C2 |
| InChI | InChI=1S/C18H16ClN7O2S/c1-21-17-4-5-18(8-17,9-17)25-29(27,28)11-2-3-13(19)12(6-11)14-7-22-16-15(20)23-10-24-26(14)16/h2-3,6-7,10,25H,4-5,8-9H2,(H2,20,23,24) |
| InChIKey | YDWNBNHMJRFLNA-UHFFFAOYSA-N |
| XLogP | 2.29 |
| TPSA | 119.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|