C19H17BrN6O2S — CID 164836768
3-(4-amino-6-bromopyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide (PubChem CID 164836768) has the molecular formula C19H17BrN6O2S and a molecular weight of 473.36 g/mol. Its IUPAC name is 3-(4-amino-6-bromopyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide.
| Compound Name | 3-(4-amino-6-bromopyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide |
|---|---|
| PubChem CID | 164836768 |
| Molecular Formula | C19H17BrN6O2S |
| Molecular Weight | 473.36 g/mol |
| Exact Mass | 472.03 |
| IUPAC Name | 3-(4-amino-6-bromopyrrolo[2,1-f][1,2,4]triazin-7-yl)-N-(4-isocyano-1-bicyclo[2.1.1]hexanyl)benzenesulfonamide |
| SMILES | [C-]#[N+]C12CCC(NS(=O)(=O)c3cccc(-c4c(Br)cc5c(N)ncnn45)c3)(C1)C2 |
| InChI | InChI=1S/C19H17BrN6O2S/c1-22-18-5-6-19(9-18,10-18)25-29(27,28)13-4-2-3-12(7-13)16-14(20)8-15-17(21)23-11-24-26(15)16/h2-4,7-8,11,25H,5-6,9-10H2,(H2,21,23,24) |
| InChIKey | HMGJXODSQOAWOY-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 106.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.36 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|