C18H25BrN6O4SSi — CID 169044959
7-bromo-3-(hydrazinecarbonyl)-N-(1-isocyanocyclopropyl)-1-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide (PubChem CID 169044959) has the molecular formula C18H25BrN6O4SSi and a molecular weight of 529.49 g/mol. Its IUPAC name is 7-bromo-3-(hydrazinecarbonyl)-N-(1-isocyanocyclopropyl)-1-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide.
| Compound Name | 7-bromo-3-(hydrazinecarbonyl)-N-(1-isocyanocyclopropyl)-1-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 169044959 |
| Molecular Formula | C18H25BrN6O4SSi |
| Molecular Weight | 529.49 g/mol |
| Exact Mass | 528.06 |
| IUPAC Name | 7-bromo-3-(hydrazinecarbonyl)-N-(1-isocyanocyclopropyl)-1-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide |
| SMILES | [C-]#[N+]C1(NS(=O)(=O)c2cc(Br)c3c(c2)c(C(=O)NN)nn3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C18H25BrN6O4SSi/c1-21-18(5-6-18)24-30(27,28)12-9-13-15(17(26)22-20)23-25(16(13)14(19)10-12)11-29-7-8-31(2,3)4/h9-10,24H,5-8,11,20H2,2-4H3,(H,22,26) |
| InChIKey | HUDSJXRXBHBLEC-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 132.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.49 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyl_hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'} |
|---|