C21H27BrF2N6O5SSi — CID 176620711
7-bromo-N-(1-cyanocyclopropyl)-3-[[(2,2-difluoroacetyl)amino]carbamoyl]-1-methyl-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide (PubChem CID 176620711) has the molecular formula C21H27BrF2N6O5SSi and a molecular weight of 621.54 g/mol. Its IUPAC name is 7-bromo-N-(1-cyanocyclopropyl)-3-[[(2,2-difluoroacetyl)amino]carbamoyl]-1-methyl-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide.
| Compound Name | 7-bromo-N-(1-cyanocyclopropyl)-3-[[(2,2-difluoroacetyl)amino]carbamoyl]-1-methyl-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 176620711 |
| Molecular Formula | C21H27BrF2N6O5SSi |
| Molecular Weight | 621.54 g/mol |
| Exact Mass | 620.07 |
| IUPAC Name | 7-bromo-N-(1-cyanocyclopropyl)-3-[[(2,2-difluoroacetyl)amino]carbamoyl]-1-methyl-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide |
| SMILES | Cn1nc(C(=O)NNC(=O)C(F)F)c2cc(S(=O)(=O)N(COCC[Si](C)(C)C)C3(C#N)CC3)cc(Br)c21 |
| InChI | InChI=1S/C21H27BrF2N6O5SSi/c1-29-17-14(16(28-29)19(31)26-27-20(32)18(23)24)9-13(10-15(17)22)36(33,34)30(21(11-25)5-6-21)12-35-7-8-37(2,3)4/h9-10,18H,5-8,12H2,1-4H3,(H,26,31)(H,27,32) |
| InChIKey | QONCZFJSIRDRIX-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 146.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 621.54 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|