C27H44N4O5Si — CID 86693737
tert-butyl 3-cyano-3-[4-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethoxymethyl)amino]-2-pyridinyl]azetidine-1-carboxylate (PubChem CID 86693737) has the molecular formula C27H44N4O5Si and a molecular weight of 532.76 g/mol. Its IUPAC name is tert-butyl 3-cyano-3-[4-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethoxymethyl)amino]-2-pyridinyl]azetidine-1-carboxylate.
| Compound Name | tert-butyl 3-cyano-3-[4-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethoxymethyl)amino]-2-pyridinyl]azetidine-1-carboxylate |
|---|---|
| PubChem CID | 86693737 |
| Molecular Formula | C27H44N4O5Si |
| Molecular Weight | 532.76 g/mol |
| Exact Mass | 532.31 |
| IUPAC Name | tert-butyl 3-cyano-3-[4-ethyl-5-[(2-methylpropan-2-yl)oxycarbonyl-(2-trimethylsilylethoxymethyl)amino]-2-pyridinyl]azetidine-1-carboxylate |
| SMILES | CCc1cc(C2(C#N)CN(C(=O)OC(C)(C)C)C2)ncc1N(COCC[Si](C)(C)C)C(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H44N4O5Si/c1-11-20-14-22(27(16-28)17-30(18-27)23(32)35-25(2,3)4)29-15-21(20)31(24(33)36-26(5,6)7)19-34-12-13-37(8,9)10/h14-15H,11-13,17-19H2,1-10H3 |
| InChIKey | RHKHOXKAZFPZGB-UHFFFAOYSA-N |
| XLogP | 5.71 |
| TPSA | 104.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.76 |
| LogP ≤ 5 | 5.71 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|