C19H27Cl2IN2O3Si — CID 170550397
tert-butyl N-(6,7-dichloro-3-iodo-1H-indol-4-yl)-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 170550397) has the molecular formula C19H27Cl2IN2O3Si and a molecular weight of 557.33 g/mol. Its IUPAC name is tert-butyl N-(6,7-dichloro-3-iodo-1H-indol-4-yl)-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-(6,7-dichloro-3-iodo-1H-indol-4-yl)-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 170550397 |
| Molecular Formula | C19H27Cl2IN2O3Si |
| Molecular Weight | 557.33 g/mol |
| Exact Mass | 556.02 |
| IUPAC Name | tert-butyl N-(6,7-dichloro-3-iodo-1H-indol-4-yl)-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(COCC[Si](C)(C)C)c1cc(Cl)c(Cl)c2[nH]cc(I)c12 |
| InChI | InChI=1S/C19H27Cl2IN2O3Si/c1-19(2,3)27-18(25)24(11-26-7-8-28(4,5)6)14-9-12(20)16(21)17-15(14)13(22)10-23-17/h9-10,23H,7-8,11H2,1-6H3 |
| InChIKey | JSPPVTLFSSXBLX-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 54.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.33 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|