C26H34Cl2N2O5SSi — CID 170550424
tert-butyl N-[6,7-dichloro-1-(4-methylphenyl)sulfonylindol-4-yl]-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 170550424) has the molecular formula C26H34Cl2N2O5SSi and a molecular weight of 585.63 g/mol. Its IUPAC name is tert-butyl N-[6,7-dichloro-1-(4-methylphenyl)sulfonylindol-4-yl]-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-[6,7-dichloro-1-(4-methylphenyl)sulfonylindol-4-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 170550424 |
| Molecular Formula | C26H34Cl2N2O5SSi |
| Molecular Weight | 585.63 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | tert-butyl N-[6,7-dichloro-1-(4-methylphenyl)sulfonylindol-4-yl]-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3c(N(COCC[Si](C)(C)C)C(=O)OC(C)(C)C)cc(Cl)c(Cl)c32)cc1 |
| InChI | InChI=1S/C26H34Cl2N2O5SSi/c1-18-8-10-19(11-9-18)36(32,33)30-13-12-20-22(16-21(27)23(28)24(20)30)29(25(31)35-26(2,3)4)17-34-14-15-37(5,6)7/h8-13,16H,14-15,17H2,1-7H3 |
| InChIKey | DLCINHITMYAIDX-UHFFFAOYSA-N |
| XLogP | 7.55 |
| TPSA | 77.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 585.63 |
| LogP ≤ 5 | 7.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|