C23H27N5O4S — CID 166010681
tert-butyl N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-propylcarbamate (PubChem CID 166010681) has the molecular formula C23H27N5O4S and a molecular weight of 469.57 g/mol. Its IUPAC name is tert-butyl N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-propylcarbamate.
| Compound Name | tert-butyl N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-propylcarbamate |
|---|---|
| PubChem CID | 166010681 |
| Molecular Formula | C23H27N5O4S |
| Molecular Weight | 469.57 g/mol |
| Exact Mass | 469.18 |
| IUPAC Name | tert-butyl N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]-N-propylcarbamate |
| SMILES | CCCN(C(=O)OC(C)(C)C)n1cnc2cnc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c21 |
| InChI | InChI=1S/C23H27N5O4S/c1-6-12-26(22(29)32-23(3,4)5)27-15-25-19-14-24-21-18(20(19)27)11-13-28(21)33(30,31)17-9-7-16(2)8-10-17/h7-11,13-15H,6,12H2,1-5H3 |
| InChIKey | RPZJERJASDCVBP-UHFFFAOYSA-N |
| XLogP | 4.21 |
| TPSA | 99.32 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.57 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |