C18H21N5O4S — CID 58009926
tert-butyl N-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamate (PubChem CID 58009926) has the molecular formula C18H21N5O4S and a molecular weight of 403.46 g/mol. Its IUPAC name is tert-butyl N-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamate |
|---|---|
| PubChem CID | 58009926 |
| Molecular Formula | C18H21N5O4S |
| Molecular Weight | 403.46 g/mol |
| Exact Mass | 403.13 |
| IUPAC Name | tert-butyl N-[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamate |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(NNC(=O)OC(C)(C)C)cnc32)cc1 |
| InChI | InChI=1S/C18H21N5O4S/c1-12-5-7-13(8-6-12)28(25,26)23-10-9-14-16(23)19-11-15(20-14)21-22-17(24)27-18(2,3)4/h5-11H,1-4H3,(H,20,21)(H,22,24) |
| InChIKey | NGRCJHBGOJOUNW-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 115.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.46 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|