C22H25N5O5S — CID 89440706
7-methyl-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-1,4-dioxaspiro[4.4]nonane-8-carbohydrazide (PubChem CID 89440706) has the molecular formula C22H25N5O5S and a molecular weight of 471.54 g/mol. Its IUPAC name is 7-methyl-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-1,4-dioxaspiro[4.4]nonane-8-carbohydrazide.
| Compound Name | 7-methyl-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-1,4-dioxaspiro[4.4]nonane-8-carbohydrazide |
|---|---|
| PubChem CID | 89440706 |
| Molecular Formula | C22H25N5O5S |
| Molecular Weight | 471.54 g/mol |
| Exact Mass | 471.16 |
| IUPAC Name | 7-methyl-N'-[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]-1,4-dioxaspiro[4.4]nonane-8-carbohydrazide |
| SMILES | Cc1ccc(S(=O)(=O)n2ccc3nc(NNC(=O)C4CC5(CC4C)OCCO5)cnc32)cc1 |
| InChI | InChI=1S/C22H25N5O5S/c1-14-3-5-16(6-4-14)33(29,30)27-8-7-18-20(27)23-13-19(24-18)25-26-21(28)17-12-22(11-15(17)2)31-9-10-32-22/h3-8,13,15,17H,9-12H2,1-2H3,(H,24,25)(H,26,28) |
| InChIKey | ILPIZVVLIQIIOS-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 124.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.54 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|