C22H26N6O5S — CID 123820039
ethyl N-[3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclopentyl]carbamate (PubChem CID 123820039) has the molecular formula C22H26N6O5S and a molecular weight of 486.55 g/mol. Its IUPAC name is ethyl N-[3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclopentyl]carbamate.
| Compound Name | ethyl N-[3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclopentyl]carbamate |
|---|---|
| PubChem CID | 123820039 |
| Molecular Formula | C22H26N6O5S |
| Molecular Weight | 486.55 g/mol |
| Exact Mass | 486.17 |
| IUPAC Name | ethyl N-[3-[[[5-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyrazin-2-yl]amino]carbamoyl]cyclopentyl]carbamate |
| SMILES | CCOC(=O)NC1CCC(C(=O)NNc2cnc3c(ccn3S(=O)(=O)c3ccc(C)cc3)n2)C1 |
| InChI | InChI=1S/C22H26N6O5S/c1-3-33-22(30)24-16-7-6-15(12-16)21(29)27-26-19-13-23-20-18(25-19)10-11-28(20)34(31,32)17-8-4-14(2)5-9-17/h4-5,8-11,13,15-16H,3,6-7,12H2,1-2H3,(H,24,30)(H,25,26)(H,27,29) |
| InChIKey | DODGFOBQAUUBJQ-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.55 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|