C24H29N3O7S2 — CID 138595376
[4-[[5-ethoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]amino]cyclohexyl]methanesulfonic acid (PubChem CID 138595376) has the molecular formula C24H29N3O7S2 and a molecular weight of 535.64 g/mol. Its IUPAC name is [4-[[5-ethoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]amino]cyclohexyl]methanesulfonic acid.
| Compound Name | [4-[[5-ethoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]amino]cyclohexyl]methanesulfonic acid |
|---|---|
| PubChem CID | 138595376 |
| Molecular Formula | C24H29N3O7S2 |
| Molecular Weight | 535.64 g/mol |
| Exact Mass | 535.14 |
| IUPAC Name | [4-[[5-ethoxycarbonyl-1-(4-methylphenyl)sulfonylpyrrolo[2,3-b]pyridin-4-yl]amino]cyclohexyl]methanesulfonic acid |
| SMILES | CCOC(=O)c1cnc2c(ccn2S(=O)(=O)c2ccc(C)cc2)c1NC1CCC(CS(=O)(=O)O)CC1 |
| InChI | InChI=1S/C24H29N3O7S2/c1-3-34-24(28)21-14-25-23-20(12-13-27(23)36(32,33)19-10-4-16(2)5-11-19)22(21)26-18-8-6-17(7-9-18)15-35(29,30)31/h4-5,10-14,17-18H,3,6-9,15H2,1-2H3,(H,25,26)(H,29,30,31) |
| InChIKey | FMOTWLBOLWEXME-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 144.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.64 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|