C26H30N4O4S2 — CID 58557230
3-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene (PubChem CID 58557230) has the molecular formula C26H30N4O4S2 and a molecular weight of 526.68 g/mol. Its IUPAC name is 3-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene.
| Compound Name | 3-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
|---|---|
| PubChem CID | 58557230 |
| Molecular Formula | C26H30N4O4S2 |
| Molecular Weight | 526.68 g/mol |
| Exact Mass | 526.17 |
| IUPAC Name | 3-[(1S,2R,4S)-4-(cyclopropylsulfonylmethyl)-2-ethylcyclopentyl]-10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaene |
| SMILES | CC[C@@H]1C[C@H](CS(=O)(=O)C2CC2)C[C@@H]1n1cnc2cnc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c21 |
| InChI | InChI=1S/C26H30N4O4S2/c1-3-19-12-18(15-35(31,32)20-8-9-20)13-24(19)29-16-28-23-14-27-26-22(25(23)29)10-11-30(26)36(33,34)21-6-4-17(2)5-7-21/h4-7,10-11,14,16,18-20,24H,3,8-9,12-13,15H2,1-2H3/t18-,19+,24-/m0/s1 |
| InChIKey | KLKVXYLEYALPFI-GLDPYIMESA-N |
| XLogP | 4.49 |
| TPSA | 103.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.68 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |