C19H22N6O2S — CID 164575240
(2R)-2-N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]butane-1,2-diamine (PubChem CID 164575240) has the molecular formula C19H22N6O2S and a molecular weight of 398.49 g/mol. Its IUPAC name is (2R)-2-N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]butane-1,2-diamine.
| Compound Name | (2R)-2-N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]butane-1,2-diamine |
|---|---|
| PubChem CID | 164575240 |
| Molecular Formula | C19H22N6O2S |
| Molecular Weight | 398.49 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | (2R)-2-N-[10-(4-methylphenyl)sulfonyl-3,5,8,10-tetrazatricyclo[7.3.0.02,6]dodeca-1,4,6,8,11-pentaen-3-yl]butane-1,2-diamine |
| SMILES | CC[C@H](CN)Nn1cnc2cnc3c(ccn3S(=O)(=O)c3ccc(C)cc3)c21 |
| InChI | InChI=1S/C19H22N6O2S/c1-3-14(10-20)23-24-12-22-17-11-21-19-16(18(17)24)8-9-25(19)28(26,27)15-6-4-13(2)5-7-15/h4-9,11-12,14,23H,3,10,20H2,1-2H3/t14-/m1/s1 |
| InChIKey | HCTKDIIHPJGZQL-CQSZACIVSA-N |
| XLogP | 2.21 |
| TPSA | 107.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |