C19H29ClN2O3SSi — CID 162390973
tert-butyl N-(5-chloro-3-methylthieno[3,2-b]pyridin-7-yl)-N-(2-trimethylsilylethoxymethyl)carbamate (PubChem CID 162390973) has the molecular formula C19H29ClN2O3SSi and a molecular weight of 429.06 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-3-methylthieno[3,2-b]pyridin-7-yl)-N-(2-trimethylsilylethoxymethyl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-3-methylthieno[3,2-b]pyridin-7-yl)-N-(2-trimethylsilylethoxymethyl)carbamate |
|---|---|
| PubChem CID | 162390973 |
| Molecular Formula | C19H29ClN2O3SSi |
| Molecular Weight | 429.06 g/mol |
| Exact Mass | 428.14 |
| IUPAC Name | tert-butyl N-(5-chloro-3-methylthieno[3,2-b]pyridin-7-yl)-N-(2-trimethylsilylethoxymethyl)carbamate |
| SMILES | Cc1csc2c(N(COCC[Si](C)(C)C)C(=O)OC(C)(C)C)cc(Cl)nc12 |
| InChI | InChI=1S/C19H29ClN2O3SSi/c1-13-11-26-17-14(10-15(20)21-16(13)17)22(18(23)25-19(2,3)4)12-24-8-9-27(5,6)7/h10-11H,8-9,12H2,1-7H3 |
| InChIKey | KVSYSFMXUBJGTI-UHFFFAOYSA-N |
| XLogP | 6.31 |
| TPSA | 51.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.06 |
| LogP ≤ 5 | 6.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|