C21H21BrClN3O5S2 — CID 170644853
tert-butyl N-[3-bromo-5-chloro-2-(3-nitrooxolan-2-yl)thieno[3,2-b]pyridin-7-yl]-N-(thiophen-2-ylmethyl)carbamate (PubChem CID 170644853) has the molecular formula C21H21BrClN3O5S2 and a molecular weight of 574.91 g/mol. Its IUPAC name is tert-butyl N-[3-bromo-5-chloro-2-(3-nitrooxolan-2-yl)thieno[3,2-b]pyridin-7-yl]-N-(thiophen-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[3-bromo-5-chloro-2-(3-nitrooxolan-2-yl)thieno[3,2-b]pyridin-7-yl]-N-(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 170644853 |
| Molecular Formula | C21H21BrClN3O5S2 |
| Molecular Weight | 574.91 g/mol |
| Exact Mass | 572.98 |
| IUPAC Name | tert-butyl N-[3-bromo-5-chloro-2-(3-nitrooxolan-2-yl)thieno[3,2-b]pyridin-7-yl]-N-(thiophen-2-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccs1)c1cc(Cl)nc2c(Br)c(C3OCCC3[N+](=O)[O-])sc12 |
| InChI | InChI=1S/C21H21BrClN3O5S2/c1-21(2,3)31-20(27)25(10-11-5-4-8-32-11)13-9-14(23)24-16-15(22)19(33-18(13)16)17-12(26(28)29)6-7-30-17/h4-5,8-9,12,17H,6-7,10H2,1-3H3 |
| InChIKey | MATWTIJKRVENMK-UHFFFAOYSA-N |
| XLogP | 6.82 |
| TPSA | 94.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.91 |
| LogP ≤ 5 | 6.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|