C23H26BrClN2O3S — CID 170386090
tert-butyl N-(3-bromo-5-chloro-2-cyclohexylfuro[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate (PubChem CID 170386090) has the molecular formula C23H26BrClN2O3S and a molecular weight of 525.90 g/mol. Its IUPAC name is tert-butyl N-(3-bromo-5-chloro-2-cyclohexylfuro[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(3-bromo-5-chloro-2-cyclohexylfuro[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 170386090 |
| Molecular Formula | C23H26BrClN2O3S |
| Molecular Weight | 525.90 g/mol |
| Exact Mass | 524.05 |
| IUPAC Name | tert-butyl N-(3-bromo-5-chloro-2-cyclohexylfuro[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccs1)c1cc(Cl)nc2c(Br)c(C3CCCCC3)oc12 |
| InChI | InChI=1S/C23H26BrClN2O3S/c1-23(2,3)30-22(28)27(13-15-10-7-11-31-15)16-12-17(25)26-19-18(24)20(29-21(16)19)14-8-5-4-6-9-14/h7,10-12,14H,4-6,8-9,13H2,1-3H3 |
| InChIKey | CJDOSLMSRDZHBU-UHFFFAOYSA-N |
| XLogP | 8.29 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.90 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|