C27H36ClN5O5S — CID 178114257
tert-butyl N-[2-chloro-5-methyl-6-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-(thiophen-2-ylmethyl)carbamate (PubChem CID 178114257) has the molecular formula C27H36ClN5O5S and a molecular weight of 578.14 g/mol. Its IUPAC name is tert-butyl N-[2-chloro-5-methyl-6-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-(thiophen-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-[2-chloro-5-methyl-6-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 178114257 |
| Molecular Formula | C27H36ClN5O5S |
| Molecular Weight | 578.14 g/mol |
| Exact Mass | 577.21 |
| IUPAC Name | tert-butyl N-[2-chloro-5-methyl-6-[(2R,3S)-3-[(2-methylpropan-2-yl)oxycarbonylamino]oxan-2-yl]pyrrolo[2,1-f][1,2,4]triazin-4-yl]-N-(thiophen-2-ylmethyl)carbamate |
| SMILES | Cc1c([C@H]2OCCC[C@@H]2NC(=O)OC(C)(C)C)cn2nc(Cl)nc(N(Cc3cccs3)C(=O)OC(C)(C)C)c12 |
| InChI | InChI=1S/C27H36ClN5O5S/c1-16-18(21-19(11-8-12-36-21)29-24(34)37-26(2,3)4)15-33-20(16)22(30-23(28)31-33)32(14-17-10-9-13-39-17)25(35)38-27(5,6)7/h9-10,13,15,19,21H,8,11-12,14H2,1-7H3,(H,29,34)/t19-,21+/m0/s1 |
| InChIKey | BWCRLDBDKLCRQG-PZJWPPBQSA-N |
| XLogP | 6.44 |
| TPSA | 107.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 578.14 |
| LogP ≤ 5 | 6.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |