C18H17ClN2O3S2 — CID 170644464
tert-butyl N-(5-chloro-3-formylthieno[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate (PubChem CID 170644464) has the molecular formula C18H17ClN2O3S2 and a molecular weight of 408.93 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-3-formylthieno[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-3-formylthieno[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 170644464 |
| Molecular Formula | C18H17ClN2O3S2 |
| Molecular Weight | 408.93 g/mol |
| Exact Mass | 408.04 |
| IUPAC Name | tert-butyl N-(5-chloro-3-formylthieno[3,2-b]pyridin-7-yl)-N-(thiophen-2-ylmethyl)carbamate |
| SMILES | CC(C)(C)OC(=O)N(Cc1cccs1)c1cc(Cl)nc2c(C=O)csc12 |
| InChI | InChI=1S/C18H17ClN2O3S2/c1-18(2,3)24-17(23)21(8-12-5-4-6-25-12)13-7-14(19)20-15-11(9-22)10-26-16(13)15/h4-7,9-10H,8H2,1-3H3 |
| InChIKey | UOYAYJJSBJQRFD-UHFFFAOYSA-N |
| XLogP | 5.77 |
| TPSA | 59.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.93 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|