C18H18ClIN2O3S — CID 154681235
tert-butyl N-(5-chloro-2-iodo-3-methylthieno[3,2-b]pyridin-7-yl)-N-(furan-2-ylmethyl)carbamate (PubChem CID 154681235) has the molecular formula C18H18ClIN2O3S and a molecular weight of 504.78 g/mol. Its IUPAC name is tert-butyl N-(5-chloro-2-iodo-3-methylthieno[3,2-b]pyridin-7-yl)-N-(furan-2-ylmethyl)carbamate.
| Compound Name | tert-butyl N-(5-chloro-2-iodo-3-methylthieno[3,2-b]pyridin-7-yl)-N-(furan-2-ylmethyl)carbamate |
|---|---|
| PubChem CID | 154681235 |
| Molecular Formula | C18H18ClIN2O3S |
| Molecular Weight | 504.78 g/mol |
| Exact Mass | 503.98 |
| IUPAC Name | tert-butyl N-(5-chloro-2-iodo-3-methylthieno[3,2-b]pyridin-7-yl)-N-(furan-2-ylmethyl)carbamate |
| SMILES | Cc1c(I)sc2c(N(Cc3ccco3)C(=O)OC(C)(C)C)cc(Cl)nc12 |
| InChI | InChI=1S/C18H18ClIN2O3S/c1-10-14-15(26-16(10)20)12(8-13(19)21-14)22(9-11-6-5-7-24-11)17(23)25-18(2,3)4/h5-8H,9H2,1-4H3 |
| InChIKey | OFEZVNCKWCGHQW-UHFFFAOYSA-N |
| XLogP | 6.40 |
| TPSA | 55.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.78 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|