C17H14ClN3O3S — CID 155060106
[5-chloro-2-(1-cyanoethyl)-3-methylthieno[3,2-b]pyridin-7-yl]-(furan-2-ylmethyl)carbamic acid (PubChem CID 155060106) has the molecular formula C17H14ClN3O3S and a molecular weight of 375.84 g/mol. Its IUPAC name is [5-chloro-2-(1-cyanoethyl)-3-methylthieno[3,2-b]pyridin-7-yl]-(furan-2-ylmethyl)carbamic acid.
| Compound Name | [5-chloro-2-(1-cyanoethyl)-3-methylthieno[3,2-b]pyridin-7-yl]-(furan-2-ylmethyl)carbamic acid |
|---|---|
| PubChem CID | 155060106 |
| Molecular Formula | C17H14ClN3O3S |
| Molecular Weight | 375.84 g/mol |
| Exact Mass | 375.04 |
| IUPAC Name | [5-chloro-2-(1-cyanoethyl)-3-methylthieno[3,2-b]pyridin-7-yl]-(furan-2-ylmethyl)carbamic acid |
| SMILES | Cc1c(C(C)C#N)sc2c(N(Cc3ccco3)C(=O)O)cc(Cl)nc12 |
| InChI | InChI=1S/C17H14ClN3O3S/c1-9(7-19)15-10(2)14-16(25-15)12(6-13(18)20-14)21(17(22)23)8-11-4-3-5-24-11/h3-6,9H,8H2,1-2H3,(H,22,23) |
| InChIKey | NWOITDLKDREGEG-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 90.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.84 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|