C20H23BrClN3O3S — CID 170330463
tert-butyl N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]propan-2-yl]carbamate (PubChem CID 170330463) has the molecular formula C20H23BrClN3O3S and a molecular weight of 500.85 g/mol. Its IUPAC name is tert-butyl N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]propan-2-yl]carbamate |
|---|---|
| PubChem CID | 170330463 |
| Molecular Formula | C20H23BrClN3O3S |
| Molecular Weight | 500.85 g/mol |
| Exact Mass | 499.03 |
| IUPAC Name | tert-butyl N-[(2S)-1-[3-bromo-5-chloro-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]propan-2-yl]carbamate |
| SMILES | C[C@@H](Cc1oc2c(NCc3cccs3)cc(Cl)nc2c1Br)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C20H23BrClN3O3S/c1-11(24-19(26)28-20(2,3)4)8-14-16(21)17-18(27-14)13(9-15(22)25-17)23-10-12-6-5-7-29-12/h5-7,9,11H,8,10H2,1-4H3,(H,23,25)(H,24,26)/t11-/m0/s1 |
| InChIKey | FPITYTKPYRUFKB-NSHDSACASA-N |
| XLogP | 6.37 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.85 |
| LogP ≤ 5 | 6.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|