C15H12BrClF2N2OS — CID 170585128
3-bromo-5-chloro-2-(1,1-difluoropropyl)-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine (PubChem CID 170585128) has the molecular formula C15H12BrClF2N2OS and a molecular weight of 421.69 g/mol. Its IUPAC name is 3-bromo-5-chloro-2-(1,1-difluoropropyl)-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine.
| Compound Name | 3-bromo-5-chloro-2-(1,1-difluoropropyl)-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170585128 |
| Molecular Formula | C15H12BrClF2N2OS |
| Molecular Weight | 421.69 g/mol |
| Exact Mass | 419.95 |
| IUPAC Name | 3-bromo-5-chloro-2-(1,1-difluoropropyl)-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine |
| SMILES | CCC(F)(F)c1oc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C15H12BrClF2N2OS/c1-2-15(18,19)14-11(16)12-13(22-14)9(6-10(17)21-12)20-7-8-4-3-5-23-8/h3-6H,2,7H2,1H3,(H,20,21) |
| InChIKey | SCAUCGPPDNCLFZ-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 38.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.69 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|