C16H16BrClFN3OS — CID 170335662
2-[(2R,3S)-2-amino-3-fluorobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine (PubChem CID 170335662) has the molecular formula C16H16BrClFN3OS and a molecular weight of 432.75 g/mol. Its IUPAC name is 2-[(2R,3S)-2-amino-3-fluorobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine.
| Compound Name | 2-[(2R,3S)-2-amino-3-fluorobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine |
|---|---|
| PubChem CID | 170335662 |
| Molecular Formula | C16H16BrClFN3OS |
| Molecular Weight | 432.75 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | 2-[(2R,3S)-2-amino-3-fluorobutyl]-3-bromo-5-chloro-N-(thiophen-2-ylmethyl)furo[3,2-b]pyridin-7-amine |
| SMILES | C[C@H](F)[C@H](N)Cc1oc2c(NCc3cccs3)cc(Cl)nc2c1Br |
| InChI | InChI=1S/C16H16BrClFN3OS/c1-8(19)10(20)5-12-14(17)15-16(23-12)11(6-13(18)22-15)21-7-9-3-2-4-24-9/h2-4,6,8,10H,5,7,20H2,1H3,(H,21,22)/t8-,10+/m0/s1 |
| InChIKey | BMAKVRCNMZEWOL-WCBMZHEXSA-N |
| XLogP | 5.15 |
| TPSA | 64.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.75 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|