C22H26ClFN4O4S — CID 170335614
tert-butyl N-[1-[5-chloro-3-[(Z)-hydroxyiminomethyl]-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-fluorobutan-2-yl]carbamate (PubChem CID 170335614) has the molecular formula C22H26ClFN4O4S and a molecular weight of 496.99 g/mol. Its IUPAC name is tert-butyl N-[1-[5-chloro-3-[(Z)-hydroxyiminomethyl]-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-fluorobutan-2-yl]carbamate.
| Compound Name | tert-butyl N-[1-[5-chloro-3-[(Z)-hydroxyiminomethyl]-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-fluorobutan-2-yl]carbamate |
|---|---|
| PubChem CID | 170335614 |
| Molecular Formula | C22H26ClFN4O4S |
| Molecular Weight | 496.99 g/mol |
| Exact Mass | 496.13 |
| IUPAC Name | tert-butyl N-[1-[5-chloro-3-[(Z)-hydroxyiminomethyl]-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-fluorobutan-2-yl]carbamate |
| SMILES | CC(F)C(Cc1oc2c(NCc3cccs3)cc(Cl)nc2c1/C=N\O)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C22H26ClFN4O4S/c1-12(24)15(27-21(29)32-22(2,3)4)8-17-14(11-26-30)19-20(31-17)16(9-18(23)28-19)25-10-13-6-5-7-33-13/h5-7,9,11-12,15,30H,8,10H2,1-4H3,(H,25,28)(H,27,29)/b26-11- |
| InChIKey | HPVTTZSOWHHPBJ-RAWMCFOBSA-N |
| XLogP | 5.76 |
| TPSA | 108.98 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.99 |
| LogP ≤ 5 | 5.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|