C25H27ClFN3O3S — CID 170335825
tert-butyl N-[(2R)-1-[5-chloro-3-ethynyl-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-(1-fluorocyclopropyl)propan-2-yl]carbamate (PubChem CID 170335825) has the molecular formula C25H27ClFN3O3S and a molecular weight of 504.03 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[5-chloro-3-ethynyl-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-(1-fluorocyclopropyl)propan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[5-chloro-3-ethynyl-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-(1-fluorocyclopropyl)propan-2-yl]carbamate |
|---|---|
| PubChem CID | 170335825 |
| Molecular Formula | C25H27ClFN3O3S |
| Molecular Weight | 504.03 g/mol |
| Exact Mass | 503.14 |
| IUPAC Name | tert-butyl N-[(2R)-1-[5-chloro-3-ethynyl-7-(thiophen-2-ylmethylamino)furo[3,2-b]pyridin-2-yl]-3-(1-fluorocyclopropyl)propan-2-yl]carbamate |
| SMILES | C#Cc1c(C[C@H](CC2(F)CC2)NC(=O)OC(C)(C)C)oc2c(NCc3cccs3)cc(Cl)nc12 |
| InChI | InChI=1S/C25H27ClFN3O3S/c1-5-17-19(11-15(13-25(27)8-9-25)29-23(31)33-24(2,3)4)32-22-18(12-20(26)30-21(17)22)28-14-16-7-6-10-34-16/h1,6-7,10,12,15H,8-9,11,13-14H2,2-4H3,(H,28,30)(H,29,31)/t15-/m1/s1 |
| InChIKey | AINLKUYLEYQGHF-OAHLLOKOSA-N |
| XLogP | 6.46 |
| TPSA | 76.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.03 |
| LogP ≤ 5 | 6.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|