C26H40F3N5O5S2Si — CID 151618643
tert-butyl 4-[methyl-[6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-4-(trifluoromethyl)-3-pyridinyl]amino]piperidine-1-carboxylate (PubChem CID 151618643) has the molecular formula C26H40F3N5O5S2Si and a molecular weight of 651.85 g/mol. Its IUPAC name is tert-butyl 4-[methyl-[6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-4-(trifluoromethyl)-3-pyridinyl]amino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[methyl-[6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-4-(trifluoromethyl)-3-pyridinyl]amino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 151618643 |
| Molecular Formula | C26H40F3N5O5S2Si |
| Molecular Weight | 651.85 g/mol |
| Exact Mass | 651.22 |
| IUPAC Name | tert-butyl 4-[methyl-[6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-4-(trifluoromethyl)-3-pyridinyl]amino]piperidine-1-carboxylate |
| SMILES | CN(c1cnc(S(=O)(=O)N(COCC[Si](C)(C)C)c2cscn2)cc1C(F)(F)F)C1CCN(C(=O)OC(C)(C)C)CC1 |
| InChI | InChI=1S/C26H40F3N5O5S2Si/c1-25(2,3)39-24(35)33-10-8-19(9-11-33)32(4)21-15-30-23(14-20(21)26(27,28)29)41(36,37)34(22-16-40-17-31-22)18-38-12-13-42(5,6)7/h14-17,19H,8-13,18H2,1-7H3 |
| InChIKey | QOARXCRREDJMOB-UHFFFAOYSA-N |
| XLogP | 5.90 |
| TPSA | 105.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 651.85 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|