C24H39N5O5S2Si — CID 150510948
tert-butyl (3S)-3-[[2-methyl-6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-3-pyridinyl]amino]pyrrolidine-1-carboxylate (PubChem CID 150510948) has the molecular formula C24H39N5O5S2Si and a molecular weight of 569.83 g/mol. Its IUPAC name is tert-butyl (3S)-3-[[2-methyl-6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-3-pyridinyl]amino]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl (3S)-3-[[2-methyl-6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-3-pyridinyl]amino]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 150510948 |
| Molecular Formula | C24H39N5O5S2Si |
| Molecular Weight | 569.83 g/mol |
| Exact Mass | 569.22 |
| IUPAC Name | tert-butyl (3S)-3-[[2-methyl-6-[1,3-thiazol-4-yl(2-trimethylsilylethoxymethyl)sulfamoyl]-3-pyridinyl]amino]pyrrolidine-1-carboxylate |
| SMILES | Cc1nc(S(=O)(=O)N(COCC[Si](C)(C)C)c2cscn2)ccc1N[C@H]1CCN(C(=O)OC(C)(C)C)C1 |
| InChI | InChI=1S/C24H39N5O5S2Si/c1-18-20(27-19-10-11-28(14-19)23(30)34-24(2,3)4)8-9-22(26-18)36(31,32)29(21-15-35-16-25-21)17-33-12-13-37(5,6)7/h8-9,15-16,19,27H,10-14,17H2,1-7H3/t19-/m0/s1 |
| InChIKey | HZVCRDULEXSKIP-IBGZPJMESA-N |
| XLogP | 4.78 |
| TPSA | 113.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.83 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|