C21H31N3O4 — CID 90708061
tert-butyl 4-[[5-(3-ethoxy-3-oxoprop-1-enyl)-2-pyridinyl]-methylamino]piperidine-1-carboxylate (PubChem CID 90708061) has the molecular formula C21H31N3O4 and a molecular weight of 389.50 g/mol. Its IUPAC name is tert-butyl 4-[[5-(3-ethoxy-3-oxoprop-1-enyl)-2-pyridinyl]-methylamino]piperidine-1-carboxylate.
| Compound Name | tert-butyl 4-[[5-(3-ethoxy-3-oxoprop-1-enyl)-2-pyridinyl]-methylamino]piperidine-1-carboxylate |
|---|---|
| PubChem CID | 90708061 |
| Molecular Formula | C21H31N3O4 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.23 |
| IUPAC Name | tert-butyl 4-[[5-(3-ethoxy-3-oxoprop-1-enyl)-2-pyridinyl]-methylamino]piperidine-1-carboxylate |
| SMILES | CCOC(=O)C=Cc1ccc(N(C)C2CCN(C(=O)OC(C)(C)C)CC2)nc1 |
| InChI | InChI=1S/C21H31N3O4/c1-6-27-19(25)10-8-16-7-9-18(22-15-16)23(5)17-11-13-24(14-12-17)20(26)28-21(2,3)4/h7-10,15,17H,6,11-14H2,1-5H3 |
| InChIKey | YOZITIJDUDKICR-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 71.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|