C29H42N8O4S2Si — CID 169045069
N-(1-isocyanocyclopropyl)-1-methyl-7-[4-(2-methylpropanoyl)piperazin-1-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide (PubChem CID 169045069) has the molecular formula C29H42N8O4S2Si and a molecular weight of 658.93 g/mol. Its IUPAC name is N-(1-isocyanocyclopropyl)-1-methyl-7-[4-(2-methylpropanoyl)piperazin-1-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide.
| Compound Name | N-(1-isocyanocyclopropyl)-1-methyl-7-[4-(2-methylpropanoyl)piperazin-1-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide |
|---|---|
| PubChem CID | 169045069 |
| Molecular Formula | C29H42N8O4S2Si |
| Molecular Weight | 658.93 g/mol |
| Exact Mass | 658.25 |
| IUPAC Name | N-(1-isocyanocyclopropyl)-1-methyl-7-[4-(2-methylpropanoyl)piperazin-1-yl]-3-(5-methyl-1,3,4-thiadiazol-2-yl)-N-(2-trimethylsilylethoxymethyl)indazole-5-sulfonamide |
| SMILES | [C-]#[N+]C1(N(COCC[Si](C)(C)C)S(=O)(=O)c2cc(N3CCN(C(=O)C(C)C)CC3)c3c(c2)c(-c2nnc(C)s2)nn3C)CC1 |
| InChI | InChI=1S/C29H42N8O4S2Si/c1-20(2)28(38)36-13-11-35(12-14-36)24-18-22(17-23-25(33-34(5)26(23)24)27-32-31-21(3)42-27)43(39,40)37(29(30-4)9-10-29)19-41-15-16-44(6,7)8/h17-18,20H,9-16,19H2,1-3,5-8H3 |
| InChIKey | VBQKWAISUQQFKO-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 118.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 658.93 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|