C25H40FN5O5SSi — CID 169032035
N-[3-(fluoromethyl)oxetan-3-yl]-4-[4-(2-methylpropanoyl)piperazin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-6-sulfonamide (PubChem CID 169032035) has the molecular formula C25H40FN5O5SSi and a molecular weight of 569.78 g/mol. Its IUPAC name is N-[3-(fluoromethyl)oxetan-3-yl]-4-[4-(2-methylpropanoyl)piperazin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-6-sulfonamide.
| Compound Name | N-[3-(fluoromethyl)oxetan-3-yl]-4-[4-(2-methylpropanoyl)piperazin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-6-sulfonamide |
|---|---|
| PubChem CID | 169032035 |
| Molecular Formula | C25H40FN5O5SSi |
| Molecular Weight | 569.78 g/mol |
| Exact Mass | 569.25 |
| IUPAC Name | N-[3-(fluoromethyl)oxetan-3-yl]-4-[4-(2-methylpropanoyl)piperazin-1-yl]-1-(2-trimethylsilylethoxymethyl)indazole-6-sulfonamide |
| SMILES | CC(C)C(=O)N1CCN(c2cc(S(=O)(=O)NC3(CF)COC3)cc3c2cnn3COCC[Si](C)(C)C)CC1 |
| InChI | InChI=1S/C25H40FN5O5SSi/c1-19(2)24(32)30-8-6-29(7-9-30)22-12-20(37(33,34)28-25(15-26)16-36-17-25)13-23-21(22)14-27-31(23)18-35-10-11-38(3,4)5/h12-14,19,28H,6-11,15-18H2,1-5H3 |
| InChIKey | FLPZBKQODJGBJT-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 106.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 569.78 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|