C30H30F4N4O5SSi — CID 155711390
6-[2,6-difluoro-3-[(6-fluoro-1-oxo-2,3-dihydroinden-4-yl)sulfonylamino]phenyl]-7-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide (PubChem CID 155711390) has the molecular formula C30H30F4N4O5SSi and a molecular weight of 662.74 g/mol. Its IUPAC name is 6-[2,6-difluoro-3-[(6-fluoro-1-oxo-2,3-dihydroinden-4-yl)sulfonylamino]phenyl]-7-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide.
| Compound Name | 6-[2,6-difluoro-3-[(6-fluoro-1-oxo-2,3-dihydroinden-4-yl)sulfonylamino]phenyl]-7-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
|---|---|
| PubChem CID | 155711390 |
| Molecular Formula | C30H30F4N4O5SSi |
| Molecular Weight | 662.74 g/mol |
| Exact Mass | 662.16 |
| IUPAC Name | 6-[2,6-difluoro-3-[(6-fluoro-1-oxo-2,3-dihydroinden-4-yl)sulfonylamino]phenyl]-7-fluoro-N-methyl-1-(2-trimethylsilylethoxymethyl)indazole-3-carboxamide |
| SMILES | CNC(=O)c1nn(COCC[Si](C)(C)C)c2c(F)c(-c3c(F)ccc(NS(=O)(=O)c4cc(F)cc5c4CCC5=O)c3F)ccc12 |
| InChI | InChI=1S/C30H30F4N4O5SSi/c1-35-30(40)28-19-6-5-18(26(33)29(19)38(36-28)15-43-11-12-45(2,3)4)25-21(32)8-9-22(27(25)34)37-44(41,42)24-14-16(31)13-20-17(24)7-10-23(20)39/h5-6,8-9,13-14,37H,7,10-12,15H2,1-4H3,(H,35,40) |
| InChIKey | NMANEGVXNWJUNW-UHFFFAOYSA-N |
| XLogP | 5.86 |
| TPSA | 119.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 662.74 |
| LogP ≤ 5 | 5.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|