C29H37F3N2O4SSi — CID 167631872
1-[6-[3-(cyclopentylmethylsulfonylmethyl)-2,6-difluorophenyl]-7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]propan-1-one (PubChem CID 167631872) has the molecular formula C29H37F3N2O4SSi and a molecular weight of 594.77 g/mol. Its IUPAC name is 1-[6-[3-(cyclopentylmethylsulfonylmethyl)-2,6-difluorophenyl]-7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]propan-1-one.
| Compound Name | 1-[6-[3-(cyclopentylmethylsulfonylmethyl)-2,6-difluorophenyl]-7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]propan-1-one |
|---|---|
| PubChem CID | 167631872 |
| Molecular Formula | C29H37F3N2O4SSi |
| Molecular Weight | 594.77 g/mol |
| Exact Mass | 594.22 |
| IUPAC Name | 1-[6-[3-(cyclopentylmethylsulfonylmethyl)-2,6-difluorophenyl]-7-fluoro-1-(2-trimethylsilylethoxymethyl)indazol-3-yl]propan-1-one |
| SMILES | CCC(=O)c1nn(COCC[Si](C)(C)C)c2c(F)c(-c3c(F)ccc(CS(=O)(=O)CC4CCCC4)c3F)ccc12 |
| InChI | InChI=1S/C29H37F3N2O4SSi/c1-5-24(35)28-22-12-11-21(27(32)29(22)34(33-28)18-38-14-15-40(2,3)4)25-23(30)13-10-20(26(25)31)17-39(36,37)16-19-8-6-7-9-19/h10-13,19H,5-9,14-18H2,1-4H3 |
| InChIKey | NXOKHXKVIBOGQC-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 78.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.77 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|