C28H28F4N6O4SSi — CID 164594495
N-[2,4-difluoro-3-[5-fluoro-1-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]phenyl]-5-fluoro-2-methoxypyridine-3-sulfonamide (PubChem CID 164594495) has the molecular formula C28H28F4N6O4SSi and a molecular weight of 648.72 g/mol. Its IUPAC name is N-[2,4-difluoro-3-[5-fluoro-1-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]phenyl]-5-fluoro-2-methoxypyridine-3-sulfonamide.
| Compound Name | N-[2,4-difluoro-3-[5-fluoro-1-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]phenyl]-5-fluoro-2-methoxypyridine-3-sulfonamide |
|---|---|
| PubChem CID | 164594495 |
| Molecular Formula | C28H28F4N6O4SSi |
| Molecular Weight | 648.72 g/mol |
| Exact Mass | 648.16 |
| IUPAC Name | N-[2,4-difluoro-3-[5-fluoro-1-[1-(2-trimethylsilylethoxymethyl)imidazol-2-yl]imidazo[1,5-a]pyridin-6-yl]phenyl]-5-fluoro-2-methoxypyridine-3-sulfonamide |
| SMILES | COc1ncc(F)cc1S(=O)(=O)Nc1ccc(F)c(-c2ccc3c(-c4nccn4COCC[Si](C)(C)C)ncn3c2F)c1F |
| InChI | InChI=1S/C28H28F4N6O4SSi/c1-41-28-22(13-17(29)14-34-28)43(39,40)36-20-7-6-19(30)23(24(20)31)18-5-8-21-25(35-15-38(21)26(18)32)27-33-9-10-37(27)16-42-11-12-44(2,3)4/h5-10,13-15,36H,11-12,16H2,1-4H3 |
| InChIKey | HZGRCKGIBXUJKR-UHFFFAOYSA-N |
| XLogP | 5.94 |
| TPSA | 112.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.72 |
| LogP ≤ 5 | 5.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|