C21H20FNO3S — CID 138582341
3-[3-(4-fluorophenyl)-6-methyl-2-sulfanylphenyl]-4-hydroxy-8-oxa-1-azaspiro[4.5]dec-3-en-2-one (PubChem CID 138582341) has the molecular formula C21H20FNO3S and a molecular weight of 385.46 g/mol. Its IUPAC name is 3-[3-(4-fluorophenyl)-6-methyl-2-sulfanylphenyl]-4-hydroxy-8-oxa-1-azaspiro[4.5]dec-3-en-2-one.
| Compound Name | 3-[3-(4-fluorophenyl)-6-methyl-2-sulfanylphenyl]-4-hydroxy-8-oxa-1-azaspiro[4.5]dec-3-en-2-one |
|---|---|
| PubChem CID | 138582341 |
| Molecular Formula | C21H20FNO3S |
| Molecular Weight | 385.46 g/mol |
| Exact Mass | 385.11 |
| IUPAC Name | 3-[3-(4-fluorophenyl)-6-methyl-2-sulfanylphenyl]-4-hydroxy-8-oxa-1-azaspiro[4.5]dec-3-en-2-one |
| SMILES | Cc1ccc(-c2ccc(F)cc2)c(S)c1C1=C(O)C2(CCOCC2)NC1=O |
| InChI | InChI=1S/C21H20FNO3S/c1-12-2-7-15(13-3-5-14(22)6-4-13)18(27)16(12)17-19(24)21(23-20(17)25)8-10-26-11-9-21/h2-7,24,27H,8-11H2,1H3,(H,23,25) |
| InChIKey | GSFVFAMZKQLPHD-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.46 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|