C19H14N4O2 — CID 138582532
3-(5-cyano-2,3-dihydroindol-1-yl)-N-(4-cyanophenyl)-3-oxopropanamide (PubChem CID 138582532) has the molecular formula C19H14N4O2 and a molecular weight of 330.35 g/mol. Its IUPAC name is 3-(5-cyano-2,3-dihydroindol-1-yl)-N-(4-cyanophenyl)-3-oxopropanamide.
| Compound Name | 3-(5-cyano-2,3-dihydroindol-1-yl)-N-(4-cyanophenyl)-3-oxopropanamide |
|---|---|
| PubChem CID | 138582532 |
| Molecular Formula | C19H14N4O2 |
| Molecular Weight | 330.35 g/mol |
| Exact Mass | 330.11 |
| IUPAC Name | 3-(5-cyano-2,3-dihydroindol-1-yl)-N-(4-cyanophenyl)-3-oxopropanamide |
| SMILES | N#Cc1ccc(NC(=O)CC(=O)N2CCc3cc(C#N)ccc32)cc1 |
| InChI | InChI=1S/C19H14N4O2/c20-11-13-1-4-16(5-2-13)22-18(24)10-19(25)23-8-7-15-9-14(12-21)3-6-17(15)23/h1-6,9H,7-8,10H2,(H,22,24) |
| InChIKey | SUXISOIYDGTQNZ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 96.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.35 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|