C8H16N2O — CID 138582776
1-oxa-3,9-diazaspiro[4.6]undecane (PubChem CID 138582776) has the molecular formula C8H16N2O and a molecular weight of 156.23 g/mol. Its IUPAC name is 1-oxa-3,9-diazaspiro[4.6]undecane.
| Compound Name | 1-oxa-3,9-diazaspiro[4.6]undecane |
|---|---|
| PubChem CID | 138582776 |
| Molecular Formula | C8H16N2O |
| Molecular Weight | 156.23 g/mol |
| Exact Mass | 156.13 |
| IUPAC Name | 1-oxa-3,9-diazaspiro[4.6]undecane |
| SMILES | C1CNCCC2(C1)CNCO2 |
| InChI | InChI=1S/C8H16N2O/c1-2-8(3-5-9-4-1)6-10-7-11-8/h9-10H,1-7H2 |
| InChIKey | QHRYENYECUXFQY-UHFFFAOYSA-N |
| XLogP | 0.08 |
| TPSA | 33.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 156.23 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |