C25H31F3N4S2 — CID 138583601
4-methyl-3-pyridin-4-yl-5-[3-[1-[2-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,3-thiazolidine (PubChem CID 138583601) has the molecular formula C25H31F3N4S2 and a molecular weight of 508.68 g/mol. Its IUPAC name is 4-methyl-3-pyridin-4-yl-5-[3-[1-[2-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,3-thiazolidine.
| Compound Name | 4-methyl-3-pyridin-4-yl-5-[3-[1-[2-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,3-thiazolidine |
|---|---|
| PubChem CID | 138583601 |
| Molecular Formula | C25H31F3N4S2 |
| Molecular Weight | 508.68 g/mol |
| Exact Mass | 508.19 |
| IUPAC Name | 4-methyl-3-pyridin-4-yl-5-[3-[1-[2-(trifluoromethyl)phenyl]-2,3,3a,4,6,6a-hexahydropyrrolo[2,3-c]pyrrol-5-yl]propylsulfanyl]-1,3-thiazolidine |
| SMILES | CC1C(SCCCN2CC3CCN(c4ccccc4C(F)(F)F)C3C2)SCN1c1ccncc1 |
| InChI | InChI=1S/C25H31F3N4S2/c1-18-24(34-17-32(18)20-7-10-29-11-8-20)33-14-4-12-30-15-19-9-13-31(23(19)16-30)22-6-3-2-5-21(22)25(26,27)28/h2-3,5-8,10-11,18-19,23-24H,4,9,12-17H2,1H3 |
| InChIKey | ZBFUSANPAFAPKQ-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 22.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 508.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|