C20H19N3O5 — CID 138585015
2-(4,5-dimethoxy-8-oxo-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-yl)butanoic acid (PubChem CID 138585015) has the molecular formula C20H19N3O5 and a molecular weight of 381.39 g/mol. Its IUPAC name is 2-(4,5-dimethoxy-8-oxo-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-yl)butanoic acid.
| Compound Name | 2-(4,5-dimethoxy-8-oxo-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-yl)butanoic acid |
|---|---|
| PubChem CID | 138585015 |
| Molecular Formula | C20H19N3O5 |
| Molecular Weight | 381.39 g/mol |
| Exact Mass | 381.13 |
| IUPAC Name | 2-(4,5-dimethoxy-8-oxo-9,14,16-triazatetracyclo[8.7.0.02,7.011,15]heptadeca-1(17),2,4,6,10,12,15-heptaen-9-yl)butanoic acid |
| SMILES | CCC(C(=O)O)n1c(=O)c2cc(OC)c(OC)cc2c2cnc3[nH]ccc3c21 |
| InChI | InChI=1S/C20H19N3O5/c1-4-14(20(25)26)23-17-10-5-6-21-18(10)22-9-13(17)11-7-15(27-2)16(28-3)8-12(11)19(23)24/h5-9,14H,4H2,1-3H3,(H,21,22)(H,25,26) |
| InChIKey | OAQDZCVTJCZDGK-UHFFFAOYSA-N |
| XLogP | 3.08 |
| TPSA | 106.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.39 |
| LogP ≤ 5 | 3.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|