C29H25N3O6 — CID 91380077
[2-[(9-methoxy-5-methyl-6-oxoisoquinolino[4,3-c]quinolin-8-yl)oxycarbonyl-methylamino]phenyl] propanoate (PubChem CID 91380077) has the molecular formula C29H25N3O6 and a molecular weight of 511.53 g/mol. Its IUPAC name is [2-[(9-methoxy-5-methyl-6-oxoisoquinolino[4,3-c]quinolin-8-yl)oxycarbonyl-methylamino]phenyl] propanoate.
| Compound Name | [2-[(9-methoxy-5-methyl-6-oxoisoquinolino[4,3-c]quinolin-8-yl)oxycarbonyl-methylamino]phenyl] propanoate |
|---|---|
| PubChem CID | 91380077 |
| Molecular Formula | C29H25N3O6 |
| Molecular Weight | 511.53 g/mol |
| Exact Mass | 511.17 |
| IUPAC Name | [2-[(9-methoxy-5-methyl-6-oxoisoquinolino[4,3-c]quinolin-8-yl)oxycarbonyl-methylamino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1N(C)C(=O)Oc1cc2c(=O)n(C)c3c4ccccc4ncc3c2cc1OC |
| InChI | InChI=1S/C29H25N3O6/c1-5-26(33)37-23-13-9-8-12-22(23)31(2)29(35)38-25-15-19-18(14-24(25)36-4)20-16-30-21-11-7-6-10-17(21)27(20)32(3)28(19)34/h6-16H,5H2,1-4H3 |
| InChIKey | WYKGVEBEVLILGH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 99.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.53 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|