C33H32N4O7 — CID 91559561
(21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-yl) N-methyl-N-[2-(pentanoylamino)phenyl]carbamate (PubChem CID 91559561) has the molecular formula C33H32N4O7 and a molecular weight of 596.64 g/mol. Its IUPAC name is (21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-yl) N-methyl-N-[2-(pentanoylamino)phenyl]carbamate.
| Compound Name | (21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-yl) N-methyl-N-[2-(pentanoylamino)phenyl]carbamate |
|---|---|
| PubChem CID | 91559561 |
| Molecular Formula | C33H32N4O7 |
| Molecular Weight | 596.64 g/mol |
| Exact Mass | 596.23 |
| IUPAC Name | (21-ethyl-16-methoxy-20-oxo-5,7-dioxa-11,21-diazapentacyclo[11.8.0.02,10.04,8.014,19]henicosa-1(13),2,4(8),9,11,14,16,18-octaen-17-yl) N-methyl-N-[2-(pentanoylamino)phenyl]carbamate |
| SMILES | CCCCC(=O)Nc1ccccc1N(C)C(=O)Oc1cc2c(=O)n(CC)c3c4cc5c(cc4ncc3c2cc1OC)OCO5 |
| InChI | InChI=1S/C33H32N4O7/c1-5-7-12-30(38)35-23-10-8-9-11-25(23)36(3)33(40)44-29-14-20-19(13-26(29)41-4)22-17-34-24-16-28-27(42-18-43-28)15-21(24)31(22)37(6-2)32(20)39/h8-11,13-17H,5-7,12,18H2,1-4H3,(H,35,38) |
| InChIKey | JQFRCZUOENUBGV-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 121.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.64 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|