C31H26N2O7 — CID 91136815
[2-[(3,12-dimethyl-13-oxo-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl)oxycarbonyl-methylamino]phenyl] propanoate (PubChem CID 91136815) has the molecular formula C31H26N2O7 and a molecular weight of 538.56 g/mol. Its IUPAC name is [2-[(3,12-dimethyl-13-oxo-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl)oxycarbonyl-methylamino]phenyl] propanoate.
| Compound Name | [2-[(3,12-dimethyl-13-oxo-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl)oxycarbonyl-methylamino]phenyl] propanoate |
|---|---|
| PubChem CID | 91136815 |
| Molecular Formula | C31H26N2O7 |
| Molecular Weight | 538.56 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | [2-[(3,12-dimethyl-13-oxo-[1,3]benzodioxolo[5,6-c]phenanthridin-2-yl)oxycarbonyl-methylamino]phenyl] propanoate |
| SMILES | CCC(=O)Oc1ccccc1N(C)C(=O)Oc1cc2c(=O)n(C)c3c4cc5c(cc4ccc3c2cc1C)OCO5 |
| InChI | InChI=1S/C31H26N2O7/c1-5-28(34)39-24-9-7-6-8-23(24)32(3)31(36)40-25-15-22-21(12-17(25)2)19-11-10-18-13-26-27(38-16-37-26)14-20(18)29(19)33(4)30(22)35/h6-15H,5,16H2,1-4H3 |
| InChIKey | IYPSEHXJWZINLR-UHFFFAOYSA-N |
| XLogP | 5.83 |
| TPSA | 96.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.56 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|