C12H15NO4 — CID 115232838
methyl 2-[methyl-(6-methyl-1,3-benzodioxol-5-yl)amino]acetate (PubChem CID 115232838) has the molecular formula C12H15NO4 and a molecular weight of 237.25 g/mol. Its IUPAC name is methyl 2-[methyl-(6-methyl-1,3-benzodioxol-5-yl)amino]acetate.
| Compound Name | methyl 2-[methyl-(6-methyl-1,3-benzodioxol-5-yl)amino]acetate |
|---|---|
| PubChem CID | 115232838 |
| Molecular Formula | C12H15NO4 |
| Molecular Weight | 237.25 g/mol |
| Exact Mass | 237.10 |
| IUPAC Name | methyl 2-[methyl-(6-methyl-1,3-benzodioxol-5-yl)amino]acetate |
| SMILES | COC(=O)CN(C)c1cc2c(cc1C)OCO2 |
| InChI | InChI=1S/C12H15NO4/c1-8-4-10-11(17-7-16-10)5-9(8)13(2)6-12(14)15-3/h4-5H,6-7H2,1-3H3 |
| InChIKey | PRATUUFIRJFBDT-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.25 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|