C11H14ClNO2 — CID 115214776
N-(2-chloroethyl)-N,6-dimethyl-1,3-benzodioxol-5-amine (PubChem CID 115214776) has the molecular formula C11H14ClNO2 and a molecular weight of 227.69 g/mol. Its IUPAC name is N-(2-chloroethyl)-N,6-dimethyl-1,3-benzodioxol-5-amine.
| Compound Name | N-(2-chloroethyl)-N,6-dimethyl-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 115214776 |
| Molecular Formula | C11H14ClNO2 |
| Molecular Weight | 227.69 g/mol |
| Exact Mass | 227.07 |
| IUPAC Name | N-(2-chloroethyl)-N,6-dimethyl-1,3-benzodioxol-5-amine |
| SMILES | Cc1cc2c(cc1N(C)CCCl)OCO2 |
| InChI | InChI=1S/C11H14ClNO2/c1-8-5-10-11(15-7-14-10)6-9(8)13(2)4-3-12/h5-6H,3-4,7H2,1-2H3 |
| InChIKey | QLFJUVYAMFPDMR-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.69 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|