C14H20N2O2 — CID 115208211
N,6-dimethyl-N-(pyrrolidin-2-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 115208211) has the molecular formula C14H20N2O2 and a molecular weight of 248.33 g/mol. Its IUPAC name is N,6-dimethyl-N-(pyrrolidin-2-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | N,6-dimethyl-N-(pyrrolidin-2-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 115208211 |
| Molecular Formula | C14H20N2O2 |
| Molecular Weight | 248.33 g/mol |
| Exact Mass | 248.15 |
| IUPAC Name | N,6-dimethyl-N-(pyrrolidin-2-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | Cc1cc2c(cc1N(C)CC1CCCN1)OCO2 |
| InChI | InChI=1S/C14H20N2O2/c1-10-6-13-14(18-9-17-13)7-12(10)16(2)8-11-4-3-5-15-11/h6-7,11,15H,3-5,8-9H2,1-2H3 |
| InChIKey | HXYFCIXYAXCTLV-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.33 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|