C14H20N2O3 — CID 115237589
N,6-dimethyl-N-(morpholin-2-ylmethyl)-1,3-benzodioxol-5-amine (PubChem CID 115237589) has the molecular formula C14H20N2O3 and a molecular weight of 264.32 g/mol. Its IUPAC name is N,6-dimethyl-N-(morpholin-2-ylmethyl)-1,3-benzodioxol-5-amine.
| Compound Name | N,6-dimethyl-N-(morpholin-2-ylmethyl)-1,3-benzodioxol-5-amine |
|---|---|
| PubChem CID | 115237589 |
| Molecular Formula | C14H20N2O3 |
| Molecular Weight | 264.32 g/mol |
| Exact Mass | 264.15 |
| IUPAC Name | N,6-dimethyl-N-(morpholin-2-ylmethyl)-1,3-benzodioxol-5-amine |
| SMILES | Cc1cc2c(cc1N(C)CC1CNCCO1)OCO2 |
| InChI | InChI=1S/C14H20N2O3/c1-10-5-13-14(19-9-18-13)6-12(10)16(2)8-11-7-15-3-4-17-11/h5-6,11,15H,3-4,7-9H2,1-2H3 |
| InChIKey | AXTZKZCPBMAHOE-UHFFFAOYSA-N |
| XLogP | 1.15 |
| TPSA | 42.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.32 |
| LogP ≤ 5 | 1.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|