C15H24N2O2 — CID 115237588
4-methoxy-N,3,5-trimethyl-N-(morpholin-2-ylmethyl)aniline (PubChem CID 115237588) has the molecular formula C15H24N2O2 and a molecular weight of 264.37 g/mol. Its IUPAC name is 4-methoxy-N,3,5-trimethyl-N-(morpholin-2-ylmethyl)aniline.
| Compound Name | 4-methoxy-N,3,5-trimethyl-N-(morpholin-2-ylmethyl)aniline |
|---|---|
| PubChem CID | 115237588 |
| Molecular Formula | C15H24N2O2 |
| Molecular Weight | 264.37 g/mol |
| Exact Mass | 264.18 |
| IUPAC Name | 4-methoxy-N,3,5-trimethyl-N-(morpholin-2-ylmethyl)aniline |
| SMILES | COc1c(C)cc(N(C)CC2CNCCO2)cc1C |
| InChI | InChI=1S/C15H24N2O2/c1-11-7-13(8-12(2)15(11)18-4)17(3)10-14-9-16-5-6-19-14/h7-8,14,16H,5-6,9-10H2,1-4H3 |
| InChIKey | WDFVHYOWQYTHQX-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 33.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|