C29H37N5O — CID 138585819
N-[5-(diethylamino)pentan-2-yl]-2-[(9-ethylcarbazol-3-yl)amino]pyridine-3-carboxamide (PubChem CID 138585819) has the molecular formula C29H37N5O and a molecular weight of 471.65 g/mol. Its IUPAC name is N-[5-(diethylamino)pentan-2-yl]-2-[(9-ethylcarbazol-3-yl)amino]pyridine-3-carboxamide.
| Compound Name | N-[5-(diethylamino)pentan-2-yl]-2-[(9-ethylcarbazol-3-yl)amino]pyridine-3-carboxamide |
|---|---|
| PubChem CID | 138585819 |
| Molecular Formula | C29H37N5O |
| Molecular Weight | 471.65 g/mol |
| Exact Mass | 471.30 |
| IUPAC Name | N-[5-(diethylamino)pentan-2-yl]-2-[(9-ethylcarbazol-3-yl)amino]pyridine-3-carboxamide |
| SMILES | CCN(CC)CCCC(C)NC(=O)c1cccnc1Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C29H37N5O/c1-5-33(6-2)19-11-12-21(4)31-29(35)24-14-10-18-30-28(24)32-22-16-17-27-25(20-22)23-13-8-9-15-26(23)34(27)7-3/h8-10,13-18,20-21H,5-7,11-12,19H2,1-4H3,(H,30,32)(H,31,35) |
| InChIKey | RQUDNVFVRFHGLW-UHFFFAOYSA-N |
| XLogP | 6.19 |
| TPSA | 62.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.65 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |