C22H20N4O2S — CID 9400408
2-(2-amino-2-oxoethyl)sulfanyl-N-(9-ethylcarbazol-3-yl)pyridine-3-carboxamide (PubChem CID 9400408) has the molecular formula C22H20N4O2S and a molecular weight of 404.50 g/mol. Its IUPAC name is 2-(2-amino-2-oxoethyl)sulfanyl-N-(9-ethylcarbazol-3-yl)pyridine-3-carboxamide.
| Compound Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-(9-ethylcarbazol-3-yl)pyridine-3-carboxamide |
|---|---|
| PubChem CID | 9400408 |
| Molecular Formula | C22H20N4O2S |
| Molecular Weight | 404.50 g/mol |
| Exact Mass | 404.13 |
| IUPAC Name | 2-(2-amino-2-oxoethyl)sulfanyl-N-(9-ethylcarbazol-3-yl)pyridine-3-carboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)c3cccnc3SCC(N)=O)ccc21 |
| InChI | InChI=1S/C22H20N4O2S/c1-2-26-18-8-4-3-6-15(18)17-12-14(9-10-19(17)26)25-21(28)16-7-5-11-24-22(16)29-13-20(23)27/h3-12H,2,13H2,1H3,(H2,23,27)(H,25,28) |
| InChIKey | FCXDESXWKPHZHH-UHFFFAOYSA-N |
| XLogP | 4.04 |
| TPSA | 90.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.50 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |